| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:47:27 UTC |
|---|
| Update Date | 2025-03-25 00:49:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02172615 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H34N2O2 |
|---|
| Molecular Mass | 394.262 |
|---|
| SMILES | CCCC(=O)NCCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
|---|
| InChI Key | ZYQYRYHSMVZCRR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic oxidesorganopnictogen compoundspiperidinessecondary carboxylic acid amidestertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholfatty acyldiphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesfatty amidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminecarboxamide groupn-acyl-aminesecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
