| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:02 UTC |
|---|
| Update Date | 2025-03-25 00:49:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02173968 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H32N2O3 |
|---|
| Molecular Mass | 312.2413 |
|---|
| SMILES | CCCCCC=CC(=O)C(NC(=O)C(N)CC(C)C)C(C)O |
|---|
| InChI Key | UUQHXZJLCDYXOF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | leucine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsalpha amino acid amidesalpha amino acidsbeta-hydroxy ketonescarboxylic acids and derivativesenoneshydrocarbon derivativesmonoalkylaminesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidesb'-hydroxy-alpha,beta-unsaturated ketones |
|---|
| Substituents | fatty acylbeta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupb'-hydroxy-alpha,beta-unsaturated-ketonefatty amidealpha,beta-unsaturated ketoneketoneorganic oxideleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compoundenonealcoholalpha-amino acid amidecarboxamide groupn-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeacryloyl-groupprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
