| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:07 UTC |
|---|
| Update Date | 2025-03-25 00:49:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02174148 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H38NO11P |
|---|
| Molecular Mass | 499.2182 |
|---|
| SMILES | CCCCCCCCCC(O)CC(=O)OC1C(O)C(CO)OC(OP(=O)(O)O)C1NC(C)=O |
|---|
| InChI Key | MHYWHAXZVRCNNH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | saccharolipids |
|---|
| Subclass | saccharolipids |
|---|
| Direct Parent | saccharolipids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosaminebeta-hydroxy acidsaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholhydroxy acidcarboxamide groupoxacyclesecondary carboxylic acid amidefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundsaccharolipidorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|