| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:10 UTC |
|---|
| Update Date | 2025-03-25 00:49:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02174273 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H29O7P |
|---|
| Molecular Mass | 352.1651 |
|---|
| SMILES | CCCCCCCCCC=CC(=O)OCC(O)COP(=O)(O)O |
|---|
| InChI Key | CERWWVVMGIUQLY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | glycerophospholipids |
|---|
| Subclass | glycerophosphates |
|---|
| Direct Parent | 1-acylglycerol-3-phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsenoate estersfatty acid estersglycerophosphateshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | enoate esteralcoholfatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acid derivativealpha,beta-unsaturated carboxylic esterfatty acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcohol1-acylglycerol-3-phosphatehydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|