| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:14 UTC |
|---|
| Update Date | 2025-03-25 00:49:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02174403 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H21N2O10P |
|---|
| Molecular Mass | 372.0934 |
|---|
| SMILES | CC(=O)NC1C(O)CC(O)=NC1C(O)C(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | LPEVFYBTRZREIC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativescyclic carboximidic acidshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary alcoholssecondary carboxylic acid amidestetrahydropyridines |
|---|
| Substituents | carbonyl groupcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamidealcoholazacycletetrahydropyridineorganic 1,3-dipolar compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundcyclic carboximidic acidorganooxygen compound |
|---|
