| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:38 UTC |
|---|
| Update Date | 2025-03-25 00:49:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02175346 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H31NO12 |
|---|
| Molecular Mass | 489.1846 |
|---|
| SMILES | COc1cc(CC(O)C(O)C(OC2OC(CO)C(O)C(O)C2NC(C)=O)C(O)C=O)ccc1O |
|---|
| InChI Key | FUIQUQUJDQSQRZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | methoxyphenols |
|---|
| Direct Parent | gingerdiols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsacetamidesalkyl aryl ethersalkyl glycosidesalpha-hydroxyaldehydesanisolescarboxylic acids and derivativesfatty acyl glycosides of mono- and disaccharideshydrocarbon derivativesmethoxybenzenesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenoxy compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acyl glycoside of mono- or disaccharidephenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharidealkyl aryl ethercarboxylic acid derivativen-acyl-alpha-hexosaminesaccharideorganic oxidealpha-hydroxyaldehydeacetalorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholgingerdiolaldehydecarboxamide groupmethoxybenzeneoxacyclesecondary carboxylic acid amideorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compoundalkyl glycoside |
|---|