| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:40 UTC |
|---|
| Update Date | 2025-03-25 00:49:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02175415 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H30ClF3N4O3 |
|---|
| Molecular Mass | 562.1959 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3(C(F)(F)F)CCC(Cn4ccnc4)(c4ccc(Cl)cc4)O3)cc2)CC1 |
|---|
| InChI Key | DRPNJCNRQRJIAP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersalkyl fluoridesamino acids and derivativesaminophenyl ethersaniline and substituted anilinesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdialkyl ethersdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesimidazolesn-arylpiperazinesn-substituted imidazolesorganic oxidesorganochloridesorganofluoridesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietyamino acid or derivativesorganochloridedialkyl etherorganonitrogen compoundaminophenyl etheracetamidearyl chloridechlorobenzeneazacyclealkyl fluorideheteroaromatic compoundaryl halidephenylpiperazinehydrocarbon derivativehalobenzenephenoxy compoundaminecarbonyl groupetheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativeorganohalogen compoundorganic oxideimidazoletertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganopnictogen compoundalkyl halidedialkylarylaminetertiary amineazolen-substituted imidazoletetrahydrofuranorganofluorideaniline or substituted anilinescarboxamide groupoxacycleorganic oxygen compoundbenzenoidorganic nitrogen compoundn-arylpiperazineorganooxygen compound |
|---|