| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:40 UTC |
|---|
| Update Date | 2025-03-25 00:49:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02175418 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H30N5+ |
|---|
| Molecular Mass | 328.2496 |
|---|
| SMILES | Cc1ncc(C[n+]2ccccc2CCCCCCCCN)c(N)n1 |
|---|
| InChI Key | YORNYFGQVGEGIB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | methylpyridines |
|---|
| Direct Parent | methylpyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkylaminesorganic cationsorganopnictogen compoundspyrimidines and pyrimidine derivatives |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compoundmethylpyridinepyrimidineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineprimary amine2-halopyridineorganic nitrogen compoundorganic cationimidolactamamine |
|---|