| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:43 UTC |
|---|
| Update Date | 2025-03-25 00:49:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02175536 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9N3O |
|---|
| Molecular Mass | 211.0746 |
|---|
| SMILES | Nc1ncnc2oc(-c3ccccc3)cc12 |
|---|
| InChI Key | KLUPXPVKDBPOMJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furo[2,3-d]pyrimidines |
|---|
| Subclass | furo[2,3-d]pyrimidines |
|---|
| Direct Parent | furo[2,3-d]pyrimidines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesfuransheteroaromatic compoundshydrocarbon derivativesimidolactamsorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | furo[2,3-d]pyrimidinefuranmonocyclic benzene moietyazacycleheteroaromatic compoundpyrimidineoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|