| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:43 UTC |
|---|
| Update Date | 2025-03-25 00:49:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02175539 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16N6O4 |
|---|
| Molecular Mass | 320.1233 |
|---|
| SMILES | Nc1ncnc2nc3ccnc-3n(CC(O)C(O)C(O)CO)c12 |
|---|
| InChI Key | MUTKKWVKGZVMHW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary alcoholsprimary aminespyrazinespyrimidines and pyrimidine derivativespyrrolespyrrolopyrazinessecondary alcohols |
|---|
| Substituents | alcoholazacycleheteroaromatic compoundpteridinepyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundpyrazinepyrroleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholimidolactamaminepyrrolopyrazineorganooxygen compound |
|---|
