Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:48:43 UTC |
---|
Update Date | 2025-03-25 00:49:38 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02175549 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H22N2O4S |
---|
Molecular Mass | 326.13 |
---|
SMILES | CS(=O)CCCCNc1ccc(C(=O)CC(N)C(=O)O)cc1 |
---|
InChI Key | TZTKJDWTDUAUSE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbonyl compounds |
---|
Direct Parent | alkyl-phenylketones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsamino acidsaryl alkyl ketonesbenzoyl derivativesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenylalkylaminessecondary alkylarylaminessulfinyl compoundssulfoxides |
---|
Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketoneamino acid or derivativesamino acidbenzoylalpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganic oxidesulfinyl compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundsecondary aminesecondary aliphatic/aromatic aminegamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesketo acidsulfoxidephenylalkylaminehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundaminealkyl-phenylketone |
---|