| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:49 UTC |
|---|
| Update Date | 2025-03-25 00:49:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02175771 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10F3NO |
|---|
| Molecular Mass | 265.0714 |
|---|
| SMILES | NC(=O)c1ccccc1-c1cccc(C(F)(F)F)c1 |
|---|
| InChI Key | QDAVBKJOGAOQJQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | trifluoromethylbenzenes |
|---|
| Direct Parent | trifluoromethylbenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidealkyl fluorideorganofluoridebenzoylbenzoic acid or derivativescarboxamide groupcarboxylic acid derivativeorganohalogen compoundbenzamidearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativeorganic nitrogen compoundtrifluoromethylbenzeneorganooxygen compound |
|---|
