Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:48:55 UTC |
---|
Update Date | 2025-03-25 00:49:41 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02176002 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C14H19N3O5PS+ |
---|
Molecular Mass | 372.0778 |
---|
SMILES | Cc1ncc(C[n+]2csc(CCOP(=O)(O)O)c2C)cc1C(N)=O |
---|
InChI Key | PJCZSVBMEIHJSU-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyridines and derivatives |
---|
Subclass | pyridinecarboxylic acids and derivatives |
---|
Direct Parent | pyridinecarboxylic acids and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 2-halopyridines4,5-disubstituted thiazolesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesmonoalkyl phosphatesnicotinamidesorganic cationsorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspolyhalopyridinesprimary carboxylic acid amides |
---|
Substituents | primary carboxylic acid amidepyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundpolyhalopyridinenicotinamidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compound2-halopyridineorganic cationazoleazacycleheteroaromatic compoundhydroxypyridinemethylpyridinecarboxamide group4,5-disubstituted 1,3-thiazoleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundthiazoleorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
---|