| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:55 UTC |
|---|
| Update Date | 2025-03-25 00:49:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176020 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H42O9 |
|---|
| Molecular Mass | 498.2829 |
|---|
| SMILES | CC1OC(OC2CCC3(C)C(CCC4C3CC(O)C3(C)C4CCC3(O)C(=O)O)C2)C(O)C(O)C1O |
|---|
| InChI Key | UEOXHACEDHBTRM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | steroidal glycosides |
|---|
| Direct Parent | steroidal glycosides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 12-hydroxysteroids17-hydroxysteroidsacetalsalpha hydroxy acids and derivativesandrostane steroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholstertiary alcohols |
|---|
| Substituents | 20-hydroxysteroidcarbonyl group12-hydroxysteroidcarboxylic acidsteroidal glycosidealpha-hydroxy acidmonosaccharidecarboxylic acid derivativealiphatic heteropolycyclic compoundsaccharideorganic oxideacetaloxaneorganoheterocyclic compound17-hydroxysteroidalcoholhydroxysteroidhydroxy acidcyclic alcoholoxacycletertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundandrostane-skeletonsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
