| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:48:56 UTC |
|---|
| Update Date | 2025-03-25 00:49:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176036 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22N2O11P2 |
|---|
| Molecular Mass | 444.0699 |
|---|
| SMILES | NC(=O)C1=CN(C2CC(O)C(COP(=O)(O)OP(=O)(O)O)C(O)C2O)C=CC1 |
|---|
| InChI Key | HYBZDMSWSIXLIJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | n-substituted nicotinamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativescyclitols and derivativescyclohexanolscyclohexylaminesdihydropyridinesenamineshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganic pyrophosphatesorganopnictogen compoundsprimary carboxylic acid amidestrialkylaminesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupamino acid or derivativescyclohexylaminecarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddihydropyridinetertiary aminealcoholvinylogous amideazacycle1,2-aminoalcoholtertiary aliphatic aminecyclohexanolcyclitol or derivativescyclic alcoholcarboxamide grouporganic pyrophosphaten-substituted nicotinamideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compoundenamine |
|---|