| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:00 UTC |
|---|
| Update Date | 2025-03-25 00:49:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176214 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H19N5O2S2 |
|---|
| Molecular Mass | 365.098 |
|---|
| SMILES | NC(N)=Nc1nc(CSCCNC(=O)Cc2ccc(O)cc2)cs1 |
|---|
| InChI Key | VKEZMYWQPDWFCZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2,4-disubstituted thiazolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersguanidinesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundguanidine1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamideorganoheterocyclic compoundazolesulfenyl compoundazacycledialkylthioetherheteroaromatic compoundorganic 1,3-dipolar compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundthioether2,4-disubstituted 1,3-thiazolephenolhydrocarbon derivativeorganic nitrogen compoundthiazoleorganooxygen compound |
|---|
