| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:01 UTC |
|---|
| Update Date | 2025-03-25 00:49:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176260 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14O4S |
|---|
| Molecular Mass | 194.0613 |
|---|
| SMILES | CC1(C)CC(C)(C)OS(=O)(=O)O1 |
|---|
| InChI Key | YZLFFGZIKLLKNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid diesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesdioxathiolaneshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | dioxathiolaneoxacycleorganic oxideorganic oxygen compoundsulfuric acid diesteralkyl sulfatealiphatic heteromonocyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
