| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:02 UTC |
|---|
| Update Date | 2025-03-25 00:49:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176298 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H28O |
|---|
| Molecular Mass | 260.214 |
|---|
| SMILES | CCC1C(C)OC(Cc2c(C)cc(C)cc2C)C1C |
|---|
| InChI Key | UAIUDUGPWYUMJJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | dialkyl ethershydrocarbon derivativesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | oxacyclemonocyclic benzene moietyetherorganic oxygen compoundaromatic heteromonocyclic compoundtetrahydrofuranhydrocarbon derivativedialkyl etherorganoheterocyclic compoundorganooxygen compound |
|---|
