| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:02 UTC |
|---|
| Update Date | 2025-03-25 00:49:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176301 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H42O10 |
|---|
| Molecular Mass | 514.2778 |
|---|
| SMILES | CC12CCC(CCC3C1C(O)CC1(C)C3CCC1(O)C(=O)O)CC2OC1OC(CO)C(O)C(O)C1O |
|---|
| InChI Key | QAKWPGCPSZFPEN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanesprimary alcoholssecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidehydroxy acidcyclic alcoholcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacycletertiary alcoholorganic oxidemonocarboxylic acid or derivativesacetalsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compound |
|---|
