| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:06 UTC |
|---|
| Update Date | 2025-03-25 00:49:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176433 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H28N2O |
|---|
| Molecular Mass | 312.2202 |
|---|
| SMILES | COc1ccc(C(CCN(C)C)c2ccc(N(C)C)cc2)cc1 |
|---|
| InChI Key | QAHQIAYJNGQYJG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaniline and substituted anilinesanisolesdialkylarylamineshydrocarbon derivativesmethoxybenzenesorganopnictogen compoundsphenoxy compoundstrialkylamines |
|---|
| Substituents | diphenylmethanephenol etheretheraniline or substituted anilinestertiary aliphatic aminealkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundanisoletertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compounddialkylarylamineaminetertiary amineorganooxygen compound |
|---|
