| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:06 UTC |
|---|
| Update Date | 2025-03-25 00:49:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176464 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H28O3 |
|---|
| Molecular Mass | 292.2038 |
|---|
| SMILES | COc1ccc(C2C(C)C(C)C(C)C(C)C2O)cc1OC |
|---|
| InChI Key | HBZDJIZTWHWKKR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | methoxybenzenes |
|---|
| Direct Parent | dimethoxybenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescyclic alcohols and derivativescyclohexanolshydrocarbon derivativesphenoxy compounds |
|---|
| Substituents | alcoholphenol etherethercyclohexanolcyclic alcoholalkyl aryl etheraromatic homomonocyclic compounddimethoxybenzeneorganic oxygen compoundanisoleo-dimethoxybenzenesecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
