| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:08 UTC |
|---|
| Update Date | 2025-03-25 00:49:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176536 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H25NO9S |
|---|
| Molecular Mass | 479.125 |
|---|
| SMILES | COc1ccc(C2Sc3ccccc3N(C3OC(C(=O)O)C(O)C(O)C3O)C(O)C2O)cc1 |
|---|
| InChI Key | CDJCDNVQAKSGSL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkanolaminesalkyl aryl ethersalkylarylthioethersanisolesazacyclic compoundsbenzothiazepinesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkylarylaminesglucuronic acid derivativeshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidmonosaccharidealkyl aryl etheralkylarylthioethercarboxylic acid derivativepyran carboxylic acidaryl thioethern-glucuronidebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundbenzothiazepineoxanedialkylarylamineorganoheterocyclic compoundalkanolaminealcoholpyran carboxylic acid or derivativesazacyclehydroxy acidmethoxybenzeneoxacyclemonocarboxylic acid or derivativesthioetherpyrananisolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|