| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:09 UTC |
|---|
| Update Date | 2025-03-25 00:49:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176569 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18I4N2O4 |
|---|
| Molecular Mass | 833.7445 |
|---|
| SMILES | CC(=O)NCC(O)C(N)Cc1cc(I)c(Oc2cc(I)c(O)c(I)c2)c(I)c1 |
|---|
| InChI Key | UHFLMCMFMIQPLZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesamphetamines and derivativesaryl iodidescarbonyl compoundscarboxylic acids and derivativesdiarylethershalophenolshydrocarbon derivativesiodobenzenesmonoalkylamineso-iodophenolsorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylbutylaminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundacetamideamphetamine or derivativesalcohol2-iodophenolcarboxamide grouparyl halidearomatic homomonocyclic compound2-halophenolsecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativeprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
