| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:11 UTC |
|---|
| Update Date | 2025-03-25 00:49:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176635 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16FN3O |
|---|
| Molecular Mass | 261.1277 |
|---|
| SMILES | CC(=O)N1CCN(c2cc3[nH]ccc3cc2F)CC1 |
|---|
| InChI Key | KMLRAWSOHBFFIB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | n-arylpiperazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaryl fluoridesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganofluoridesorganopnictogen compoundspyrrolestertiary carboxylic acid amides |
|---|
| Substituents | aryl fluoridecarbonyl groupamino acid or derivativesindolecarboxylic acid derivativeorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundtertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineacetamideazacycleorganofluorideheteroaromatic compoundindole or derivativescarboxamide grouparyl halideorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|