| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:11 UTC |
|---|
| Update Date | 2025-03-25 00:49:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176652 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H31NO3 |
|---|
| Molecular Mass | 453.2304 |
|---|
| SMILES | Oc1ccc2cc(C(O)CN3CCC(C(O)(c4ccccc4)c4ccccc4)CC3)ccc2c1 |
|---|
| InChI Key | NCHNTPVYWMWZMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcohols1-hydroxy-2-unsubstituted benzenoidsaromatic alcoholsazacyclic compoundshydrocarbon derivativesnaphthols and derivativesorganopnictogen compoundspiperidinessecondary alcoholstertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethane1-hydroxy-2-unsubstituted benzenoidaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidine2-naphtholtertiary amineorganoheterocyclic compoundalcoholazacycle1,2-aminoalcoholtertiary aliphatic aminetertiary alcoholnaphthaleneorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
