| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:13 UTC |
|---|
| Update Date | 2025-03-25 00:49:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176717 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O7S |
|---|
| Molecular Mass | 235.9991 |
|---|
| SMILES | O=C(O)SC1=C(O)C(=O)OC1C(O)CO |
|---|
| InChI Key | UZJCCXBDNFTPEW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | dihydrofurans |
|---|
| Subclass | furanones |
|---|
| Direct Parent | butenolides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundsdihydrofuransenoate estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganic thiocarbonic acid derivativesoxacyclic compoundsprimary alcoholssecondary alcoholssulfenyl compoundsthiolactones |
|---|
| Substituents | carbonyl groupthiocarbonic acid derivativeorganosulfur compoundcarboxylic acid derivativelactonealpha,beta-unsaturated carboxylic ester2-furanoneorganic oxidealiphatic heteromonocyclic compoundprimary alcoholthiolactone1,2-diolenoate esteralcoholcarbonic acid derivativesulfenyl compoundoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|