| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:15 UTC |
|---|
| Update Date | 2025-03-25 00:49:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176796 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO5S |
|---|
| Molecular Mass | 323.0827 |
|---|
| SMILES | CCN(CC(O)C(=O)O)S(=O)(=O)c1cccc2ccccc12 |
|---|
| InChI Key | MYSBMADIHIGMHJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonamidesalpha hydroxy acids and derivativesaminosulfonyl compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidessecondary alcohols |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharideorganosulfur compoundcarboxylic acid derivative1-naphthalene sulfonic acid or derivativesorganosulfonic acid amidesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundalcoholaminosulfonyl compoundaromatic homopolycyclic compoundnaphthalene sulfonamidehydroxy acidmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholhydrocarbon derivativeorganic nitrogen compound1-naphthalene sulfonamideorganooxygen compound |
|---|