| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:17 UTC |
|---|
| Update Date | 2025-03-25 00:49:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176864 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13NO6 |
|---|
| Molecular Mass | 219.0743 |
|---|
| SMILES | O=C(O)CCON1CC(O)CC1C(=O)O |
|---|
| InChI Key | LBBJULWADCGZSU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | proline and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesn-organohydroxylaminesorganic oxidesorganopnictogen compoundspyrrolidine carboxylic acidssecondary alcohols |
|---|
| Substituents | proline or derivativesalcoholcarbonyl groupcarboxylic acidazacyclen-organohydroxylamineorganic oxidepyrrolidine carboxylic acid or derivativesorganic oxygen compoundpyrrolidine carboxylic acidaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidsecondary alcoholdicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundpyrrolidineorganoheterocyclic compoundorganooxygen compound |
|---|
