| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:17 UTC |
|---|
| Update Date | 2025-03-25 00:49:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176876 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12O4S |
|---|
| Molecular Mass | 228.0456 |
|---|
| SMILES | COS(=O)(=O)OC(C)=Cc1ccccc1 |
|---|
| InChI Key | OMKLIPGQDPQYDG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid diesters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxideorganic oxygen compoundsulfuric acid diesteralkyl sulfatehydrocarbon derivativebenzenoidorganooxygen compound |
|---|