| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:20 UTC |
|---|
| Update Date | 2025-03-25 00:49:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02176982 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13O7P |
|---|
| Molecular Mass | 240.0399 |
|---|
| SMILES | O=C(O)C1(O)CCCC1COP(=O)(O)O |
|---|
| InChI Key | WFPVMNOSYIMADE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic alcohols and derivativescyclopentanolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidhydroxy acidcyclic alcoholcarboxylic acid derivativecyclopentanoltertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatealiphatic homomonocyclic compoundhydrocarbon derivativeorganooxygen compound |
|---|
