| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:23 UTC |
|---|
| Update Date | 2025-03-25 00:49:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177105 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H21NO2 |
|---|
| Molecular Mass | 295.1572 |
|---|
| SMILES | COc1ccc2c(c1)-c1ccc(OC)cc1C1CN(C)CC21 |
|---|
| InChI Key | WFAOIUFKDDAGDG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundshydrocarbon derivativesisoindolesisoindolinesn-alkylpyrrolidinesnaphthalenesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | phenol etheretheralkyl aryl etherisoindolinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinetertiary amineorganoheterocyclic compoundphenanthreneazacyclen-alkylpyrrolidineisoindoletertiary aliphatic aminenaphthaleneorganic oxygen compoundanisoleisoindole or derivativeshydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
