| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:24 UTC |
|---|
| Update Date | 2025-03-25 00:49:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177154 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H19NO4 |
|---|
| Molecular Mass | 289.1314 |
|---|
| SMILES | CN1CCC23OC(=O)CCC2C1Cc1c(O)cc(O)cc13 |
|---|
| InChI Key | JJRFAFONEXQKSV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | naphthopyrans |
|---|
| Subclass | naphthopyrans |
|---|
| Direct Parent | naphthopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsamino acids and derivativesazacyclic compoundsbenzazocinescarbonyl compoundscarboxylic acid estersdelta valerolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespiperidinespyranstetralinstrialkylamines |
|---|
| Substituents | tetralincarbonyl groupamino acid or derivativesdelta valerolactone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxanepiperidinedelta_valerolactonetertiary amineazacycletertiary aliphatic amine1-hydroxy-4-unsubstituted benzenoidoxacyclenaphthopyranmonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundpyranbenzazocinecarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
