| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:24 UTC |
|---|
| Update Date | 2025-03-25 00:49:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177162 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO7 |
|---|
| Molecular Mass | 313.1162 |
|---|
| SMILES | COc1ccc(NC(=O)OC2CC(O)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | IDZDPWLEXCVESK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylcarbamic acid esters |
|---|
| Direct Parent | phenylcarbamic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarbamate esterscarbonyl compoundscyclitols and derivativescyclohexanolshydrocarbon derivativesmethoxybenzenesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compounds |
|---|
| Substituents | phenol ethercarbonyl groupetheralkyl aryl etherorganic oxideorganonitrogen compoundorganopnictogen compoundalcoholcarbonic acid derivativecyclohexanolcarbamic acid estercyclitol or derivativescyclic alcoholmethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativephenylcarbamic acid esterorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
