| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:26 UTC |
|---|
| Update Date | 2025-03-25 00:49:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177223 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11O5P |
|---|
| Molecular Mass | 230.0344 |
|---|
| SMILES | COP(=O)(OC)c1ccccc1C(=O)O |
|---|
| InChI Key | YWCMANHHPCTKLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compoundsphosphonic acid diestersphosphonic acid esters |
|---|
| Substituents | carboxylic acidbenzoylphosphonic acid diestercarboxylic acid derivativephosphonic acid esteraromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganophosphonic acid derivativeorganooxygen compound |
|---|