| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:26 UTC |
|---|
| Update Date | 2025-03-25 00:49:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177235 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17NO3S |
|---|
| Molecular Mass | 267.0929 |
|---|
| SMILES | Cc1ccc(NC(=O)CSCCC(=O)O)c(C)c1 |
|---|
| InChI Key | LYMVBMKYXOJBGZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkylthioethershydrocarbon derivativesmonocarboxylic acids and derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compoundsm-xylenes |
|---|
| Substituents | carbonyl groupcarboxylic acidn-arylamideorganosulfur compoundcarboxylic acid derivativexyleneorganic oxideorganonitrogen compoundorganopnictogen compoundsulfenyl compounddialkylthioetherm-xylenecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
