Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:49:28 UTC |
---|
Update Date | 2025-03-25 00:49:53 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02177291 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C13H23NO17S2 |
---|
Molecular Mass | 529.0407 |
---|
SMILES | COC1OC(CS(=O)(=O)O)C(OC2OC(C(=O)O)C(O)C(O)C2O)C(O)C1NOS(=O)(=O)O |
---|
InChI Key | VNUYKNUQZYVXPN-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic sulfuric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acidsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssulfonyls |
---|
Substituents | organosulfonic acid or derivativescarbonyl groupcarboxylic acidorganosulfonic acido-glucuronidemonosaccharideorganosulfur compoundcarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativessulfonylorganic sulfonic acid or derivativespyransecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
---|