| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:30 UTC |
|---|
| Update Date | 2025-03-25 00:49:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177404 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H30N2O3 |
|---|
| Molecular Mass | 370.2256 |
|---|
| SMILES | COCCc1ccc(OCC(O)CN2CCN(c3ccccc3)CC2)cc1 |
|---|
| InChI Key | AVTWUMBMHBFZRP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsalkyl aryl ethersaniline and substituted anilinesazacyclic compoundsdialkyl ethersdialkylarylamineshydrocarbon derivativesn-alkylpiperazinesn-arylpiperazinesorganopnictogen compoundsphenol ethersphenoxy compoundssecondary alcoholstrialkylaminestyrosols and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraromatic heteromonocyclic compoundalkyl aryl etherdialkyl ethertertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compoundtyrosol derivativedialkylarylaminetertiary aminealcoholazacycle1,2-aminoalcoholaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminephenylpiperazineorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
