| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:31 UTC |
|---|
| Update Date | 2025-03-25 00:49:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177435 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N5O2 |
|---|
| Molecular Mass | 209.0913 |
|---|
| SMILES | COCn1cnc2c(=O)n(C)c(N)nc21 |
|---|
| InChI Key | RFSVWHVVNIJJSV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidelactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundazolen-substituted imidazole |
|---|