| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:33 UTC |
|---|
| Update Date | 2025-03-25 00:49:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177507 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O7 |
|---|
| Molecular Mass | 316.0583 |
|---|
| SMILES | Oc1cc(O)c2c(O)c(-c3ccc(O)c(O)c3O)c(O)cc2c1 |
|---|
| InChI Key | RFARLOWQMQRXDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | phenylnaphthalenes |
|---|
| Direct Parent | phenylnaphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-unsubstituted pyrrogallolsbenzene and substituted derivativeshydrocarbon derivativesnaphthols and derivativesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietypyrogallol derivativebenzenetriol1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidorganic oxygen compound5-unsubstituted pyrrogallolphenylnaphthalenephenolhydrocarbon derivative1-naphthol2-naphtholorganooxygen compound |
|---|
