| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:36 UTC |
|---|
| Update Date | 2025-03-25 00:49:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177604 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13N5 |
|---|
| Molecular Mass | 251.1171 |
|---|
| SMILES | Cc1cc2nc(N)c(-c3ccccc3)nc2c(N)n1 |
|---|
| InChI Key | QZDUKFOKSSTUDT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridopyrazines |
|---|
| Subclass | pyridopyrazines |
|---|
| Direct Parent | pyridopyrazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundspolyhalopyridinesprimary aminespyrazinespyridines and derivatives |
|---|
| Substituents | pyridopyrazinemonocyclic benzene moietyazacyclepolyhalopyridineheteroaromatic compoundpyridinearomatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amine2-halopyridineorganic nitrogen compoundimidolactamamine |
|---|
