| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:36 UTC |
|---|
| Update Date | 2025-03-25 00:49:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177630 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H28O8 |
|---|
| Molecular Mass | 444.1784 |
|---|
| SMILES | Cc1cc2c(CCC(=O)O)c(CCC(=O)O)c(CCC(=O)O)c(CCC(=O)O)c2cc1C |
|---|
| InChI Key | ULLICUIUSMZPBD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesnaphthalenesorganic oxides |
|---|
| Substituents | carbonyl grouporganic oxidenaphthalenecarboxylic acidorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativetetracarboxylic acid or derivativesbenzenoidorganooxygen compound |
|---|
