| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:37 UTC |
|---|
| Update Date | 2025-03-25 00:49:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177661 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O8 |
|---|
| Molecular Mass | 374.1002 |
|---|
| SMILES | COc1cc(C2c3cc4c(cc3C(O)C2C(=O)O)OCO4)cc(O)c1OC |
|---|
| InChI Key | KMBQVINGXUXRPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | methoxyphenols |
|---|
| Direct Parent | methoxyphenols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl aryl ethersanisolesbenzodioxolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdimethoxybenzeneshydrocarbon derivativesindanesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundssecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidmethoxyphenol1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativedimethoxybenzenebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundo-dimethoxybenzeneorganoheterocyclic compoundbenzodioxolealcoholhydroxy acid1-hydroxy-4-unsubstituted benzenoidmethoxybenzeneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisoleindanesecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
