| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:39 UTC |
|---|
| Update Date | 2025-03-25 00:49:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177729 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O |
|---|
| Molecular Mass | 202.1358 |
|---|
| SMILES | Cc1cc2c(c(O)c1C)C=CCC2(C)C |
|---|
| InChI Key | AQINKXUVWSPMGP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesorganooxygen compounds |
|---|
| Substituents | organic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivative1-naphthol1-hydroxy-4-unsubstituted benzenoidorganooxygen compound |
|---|
