| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:41 UTC |
|---|
| Update Date | 2025-03-25 00:49:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177824 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O4S |
|---|
| Molecular Mass | 238.03 |
|---|
| SMILES | COS(=O)(=O)c1ccc2c(O)cccc2c1 |
|---|
| InChI Key | PNGFDEBTVWUMBA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 2-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-naphthalene sulfonatesarylsulfonic acids and derivativeshydrocarbon derivativesnaphthols and derivativesorganic oxidesorganooxygen compoundsorganosulfonic acid esterssulfonyls |
|---|
| Substituents | organosulfonic acid or derivatives1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidorganosulfur compoundorganosulfonic acid ester2-naphthalene sulfonic acid or derivativesorganic oxidesulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativesnaphthalene sulfonatehydrocarbon derivative1-naphthol2-naphthalene sulfonateorganooxygen compound |
|---|