| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:42 UTC |
|---|
| Update Date | 2025-03-25 00:49:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177875 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18O10 |
|---|
| Molecular Mass | 370.09 |
|---|
| SMILES | COc1cc(C(=O)OC2CC(O)(C(=O)O)CC(O)C2C(=O)O)ccc1O |
|---|
| InChI Key | AXPCEKQGHXBHMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | quinic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersalpha hydroxy acids and derivativesanisolesbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidscyclohexanolshydrocarbon derivativesm-methoxybenzoic acids and derivativesmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundstertiary alcoholstricarboxylic acids and derivativesp-hydroxybenzoic acid alkyl esters |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidalpha-hydroxy acidp-hydroxybenzoic acid esterbenzoyl1-hydroxy-2-unsubstituted benzenoidmethoxyphenoltricarboxylic acid or derivativesbenzoate esteralkyl aryl ethercarboxylic acid derivativebeta-hydroxy acidorganic oxidem-methoxybenzoic acid or derivativescyclohexanolbenzoic acid or derivativeshydroxy acidmethoxybenzenep-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundtertiary alcoholanisolecarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundquinic acid |
|---|