| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:43 UTC |
|---|
| Update Date | 2025-03-25 00:49:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177880 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H38N2O5 |
|---|
| Molecular Mass | 542.2781 |
|---|
| SMILES | Cc1ccc(-c2c(-c3ccccc3)c(C(=O)Nc3ccc(O)cc3)c(C(C)C)n2CCC(O)CC(O)CO)cc1 |
|---|
| InChI Key | BJJLDPBCGLDFBN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | aromatic anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholspyrrole carboxamidessecondary alcoholssecondary carboxylic acid amidessubstituted pyrrolestoluenesvinylogous amides |
|---|
| Substituents | aromatic heteromonocyclic compoundpyrrole-3-carboxylic acid or derivatives1-hydroxy-2-unsubstituted benzenoidsubstituted pyrrolecarboxylic acid derivativearomatic anilideorganic oxideorganonitrogen compoundpyrrole-3-carboxamideorganopnictogen compoundprimary alcoholorganoheterocyclic compoundalcoholvinylogous amideazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundpyrrolesecondary alcoholphenolhydrocarbon derivativeorganic nitrogen compoundtolueneorganooxygen compound |
|---|
