Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:49:44 UTC |
---|
Update Date | 2025-03-25 00:49:59 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02177954 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C10H9Cl2NO5 |
---|
Molecular Mass | 292.9858 |
---|
SMILES | COc1cc(C(=O)NCC(=O)O)c(Cl)c(Cl)c1O |
---|
InChI Key | YCLRNASOSNAVHF-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | acyl glycines |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 2-halobenzoic acids and derivatives3-halobenzoic acids and derivativesalkyl aryl ethersalpha amino acidsanisolesaryl chloridesbenzoyl derivativescarbonyl compoundscarboxylic acidsdichlorobenzeneshalophenolshippuric acids and derivativeshydrocarbon derivativesm-chlorophenolsmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidesvinylogous halides |
---|
Substituents | phenol ethermonocyclic benzene moietycarboxylic acid3-halobenzoic acid or derivativesorganochloridebenzoylmethoxyphenolorganonitrogen compoundalpha-amino acidaryl chloride2-chlorophenolchlorobenzene3-chlorophenolmethoxybenzenevinylogous haliden-acylglycinearyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amideanisolephenolhydrocarbon derivativehalobenzenephenoxy compoundcarbonyl groupetheralkyl aryl etherorganohalogen compoundbenzamideorganic oxideorganopnictogen compound1,2-dichlorobenzene3-halophenolhippuric acid or derivativesbenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide group2-halobenzoic acid or derivatives2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
---|