| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:44 UTC |
|---|
| Update Date | 2025-03-25 00:49:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177954 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9Cl2NO5 |
|---|
| Molecular Mass | 292.9858 |
|---|
| SMILES | COc1cc(C(=O)NCC(=O)O)c(Cl)c(Cl)c1O |
|---|
| InChI Key | YCLRNASOSNAVHF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 2-halobenzoic acids and derivatives3-halobenzoic acids and derivativesalkyl aryl ethersalpha amino acidsanisolesaryl chloridesbenzoyl derivativescarbonyl compoundscarboxylic acidsdichlorobenzeneshalophenolshippuric acids and derivativeshydrocarbon derivativesm-chlorophenolsmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidesvinylogous halides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acid3-halobenzoic acid or derivativesorganochloridebenzoylmethoxyphenolorganonitrogen compoundalpha-amino acidaryl chloride2-chlorophenolchlorobenzene3-chlorophenolmethoxybenzenevinylogous haliden-acylglycinearyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amideanisolephenolhydrocarbon derivativehalobenzenephenoxy compoundcarbonyl groupetheralkyl aryl etherorganohalogen compoundbenzamideorganic oxideorganopnictogen compound1,2-dichlorobenzene3-halophenolhippuric acid or derivativesbenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide group2-halobenzoic acid or derivatives2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|