| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:45 UTC |
|---|
| Update Date | 2025-03-25 00:49:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02177958 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N4O2S+ |
|---|
| Molecular Mass | 281.1067 |
|---|
| SMILES | Cc1ncc(C[n+]2csc(CC(O)CO)c2)c(N)n1 |
|---|
| InChI Key | GXQWSATWTKWZCI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidines and pyrimidine derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic cationsorganopnictogen compoundsprimary alcoholsprimary aminessecondary alcoholsthiazoles |
|---|
| Substituents | alcoholaromatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidineorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationprimary alcoholimidolactamthiazoleamineorganooxygen compoundazole1,2-diol |
|---|
