| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:46 UTC |
|---|
| Update Date | 2025-03-25 00:49:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178007 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24Cl2N2O3 |
|---|
| Molecular Mass | 362.1164 |
|---|
| SMILES | OCCOCCOCCN1CCN(c2ccc(Cl)cc2Cl)CC1 |
|---|
| InChI Key | AEFFUGFIWKXBBN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaniline and substituted anilinesaryl chloridesazacyclic compoundsdialkyl ethersdialkylarylaminesdichlorobenzeneshydrocarbon derivativesn-alkylpiperazinesn-arylpiperazinesorganochloridesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | monocyclic benzene moietyetheraromatic heteromonocyclic compoundorganochlorideorganohalogen compounddialkyl ether1,3-dichlorobenzenetertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary aminearyl chloridechlorobenzenealcoholazacycleaniline or substituted anilinesn-alkylpiperazinetertiary aliphatic aminearyl halidephenylpiperazineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneaminen-arylpiperazineorganooxygen compound |
|---|
