| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:49:47 UTC |
|---|
| Update Date | 2025-03-25 00:49:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02178038 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O3 |
|---|
| Molecular Mass | 234.1256 |
|---|
| SMILES | COC(=O)CCC(=O)c1c(C)ccc(C)c1C |
|---|
| InChI Key | BDIYGNWAJQXEED-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl alkyl ketonesbenzoyl derivativesbutyrophenonesfatty acid methyl estersgamma-keto acids and derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | fatty acylmonocyclic benzene moietyaryl alkyl ketonebenzoylcarboxylic acid derivativeorganic oxidemethyl estergamma-keto acidbutyrophenonearomatic homomonocyclic compoundfatty acid estermonocarboxylic acid or derivativesfatty acid methyl esterketo acidcarboxylic acid esterhydrocarbon derivativebenzenoidalkyl-phenylketone |
|---|